EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | [H][C@@]12CC=C(C)[C@H](C[C@@]34O[C@]3([H])C(=O)C(CO)=C[C@H]4O)[C@@]1(C)CCC[C@@]2(C)CO |
| InChI | InChI=1S/C22H32O5/c1-13-5-6-16-20(2,12-24)7-4-8-21(16,3)15(13)10-22-17(25)9-14(11-23)18(26)19(22)27-22/h5,9,15-17,19,23-25H,4,6-8,10-12H2,1-3H3/t15-,16-,17+,19+,20-,21+,22-/m0/s1 |
| InChIKey | ZDPDGXFDHFNCDK-OJXKLFIISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraconiothyrium (ncbitaxon:300251) | mycelium (BTO:0001436) | PubMed (21114274) | Ethyl acetate extract of culture medium and mycelium |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epoxypholamin A (CHEBI:70281) has role metabolite (CHEBI:25212) |
| Epoxypholamin A (CHEBI:70281) is a enol ether (CHEBI:47985) |
| Epoxypholamin A (CHEBI:70281) is a enone (CHEBI:51689) |
| Citations |
|---|