EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31ClN2O5 |
| Net Charge | 0 |
| Average Mass | 402.919 |
| Monoisotopic Mass | 402.19215 |
| SMILES | C/C(=C\CC[C@@](C)(Cl)[C@H](O)Cc1cnc([N+](=O)[O-])c1)CC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C19H31ClN2O5/c1-13(7-8-15(23)18(2,3)25)6-5-9-19(4,20)16(24)10-14-11-17(21-12-14)22(26)27/h6,11-12,15-16,21,23-25H,5,7-10H2,1-4H3/b13-6+/t15-,16-,19-/m1/s1 |
| InChIKey | CAJMFLABBNVXCD-BMGPEXAXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species CNQ-509 (ncbitaxon:444103) | - | PubMed (21090803) | The strain belongs to the "MAR4" group of marine actinomycetes |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nitropyrrolin E (CHEBI:70280) has role metabolite (CHEBI:25212) |
| Nitropyrrolin E (CHEBI:70280) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (E,3R,10R,11R)-10-chloro-2,6,10-trimethyl-12-(5-nitro-1H-pyrrol-3-yl)dodec-6-ene-2,3,11-triol | ChEBI |
| Citations |
|---|