EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28N2O3 |
| Net Charge | 0 |
| Average Mass | 332.444 |
| Monoisotopic Mass | 332.20999 |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@]1(C)O[C@@H]1Cc1cnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H28N2O3/c1-14(2)7-5-8-15(3)9-6-10-19(4)17(24-19)11-16-12-18(20-13-16)21(22)23/h7,9,12-13,17,20H,5-6,8,10-11H2,1-4H3/b15-9+/t17-,19-/m1/s1 |
| InChIKey | NDZMZBQXLOVJER-AXTVGJDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species CNQ-509 (ncbitaxon:444103) | - | PubMed (21090803) | The strain belongs to the "MAR4" group of marine actinomycetes |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nitropyrrolin B (CHEBI:70277) has role metabolite (CHEBI:25212) |
| Nitropyrrolin B (CHEBI:70277) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| 4-[[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methyl]-2-nitro-1H-pyrrole | ChEBI |
| Citations |
|---|