EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O3 |
| Net Charge | 0 |
| Average Mass | 458.727 |
| Monoisotopic Mass | 458.37600 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@]3([H])C(=C)CCC(O)C(C)(C)O)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H50O3/c1-19(9-12-25(32)27(4,5)33)20-13-17-29(7)21(20)10-11-23-28(6)16-15-24(31)26(2,3)22(28)14-18-30(23,29)8/h20-23,25,32-33H,1,9-18H2,2-8H3/t20-,21-,22+,23-,25?,28+,29-,30-/m1/s1 |
| InChIKey | RHHDOPOBWMUHDL-HVZYUJLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24,25-dihydroxydammar-20-en-3-one (CHEBI:70275) has parent hydride dammarane (CHEBI:36488) |
| 24,25-dihydroxydammar-20-en-3-one (CHEBI:70275) has role plant metabolite (CHEBI:76924) |
| 24,25-dihydroxydammar-20-en-3-one (CHEBI:70275) is a cyclic terpene ketone (CHEBI:36130) |
| 24,25-dihydroxydammar-20-en-3-one (CHEBI:70275) is a diol (CHEBI:23824) |
| 24,25-dihydroxydammar-20-en-3-one (CHEBI:70275) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| 24,25-dihydroxydammar-20-en-3-one |