EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O3 |
| Net Charge | 0 |
| Average Mass | 460.743 |
| Monoisotopic Mass | 460.39165 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]([H])([C@]4(C)CC[C@@H](C(C)(C)O)O4)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H52O3/c1-25(2)21-12-17-29(7)22(27(21,5)15-13-23(25)31)10-9-19-20(11-16-28(19,29)6)30(8)18-14-24(33-30)26(3,4)32/h19-24,31-32H,9-18H2,1-8H3/t19-,20+,21+,22-,23-,24+,27+,28-,29-,30+/m1/s1 |
| InChIKey | RQBNSDSKUAGBOI-ZNYSIYOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabraleadiol (CHEBI:70272) has parent hydride dammarane (CHEBI:36488) |
| cabraleadiol (CHEBI:70272) has role plant metabolite (CHEBI:76924) |
| cabraleadiol (CHEBI:70272) is a diol (CHEBI:23824) |
| cabraleadiol (CHEBI:70272) is a oxolanes (CHEBI:26912) |
| cabraleadiol (CHEBI:70272) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3α,24S)-20,24-epoxydammarane-3,25-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1437381 | Reaxys |
| Citations |
|---|