EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O4 |
| Net Charge | 0 |
| Average Mass | 458.683 |
| Monoisotopic Mass | 458.33961 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]([H])([C@]4(C)CCC(=O)O4)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C29H46O4/c1-18(30)32-23-12-14-26(4)21(25(23,2)3)11-16-28(6)22(26)9-8-19-20(10-15-27(19,28)5)29(7)17-13-24(31)33-29/h19-23H,8-17H2,1-7H3/t19-,20+,21+,22-,23-,26+,27-,28-,29+/m1/s1 |
| InChIKey | CKGAIIJMVWESST-LKJFLBAOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabraleahydroxylactone acetate (CHEBI:70270) has role plant metabolite (CHEBI:76924) |
| cabraleahydroxylactone acetate (CHEBI:70270) is a acetate ester (CHEBI:47622) |
| cabraleahydroxylactone acetate (CHEBI:70270) is a tetracyclic triterpenoid (CHEBI:26893) |
| cabraleahydroxylactone acetate (CHEBI:70270) is a γ-lactone (CHEBI:37581) |
| Citations |
|---|