EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]([H])([C@]4(C)CCC(=O)O4)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C27H44O3/c1-23(2)19-10-15-26(5)20(24(19,3)13-11-21(23)28)8-7-17-18(9-14-25(17,26)4)27(6)16-12-22(29)30-27/h17-21,28H,7-16H2,1-6H3/t17-,18+,19+,20-,21-,24+,25-,26-,27+/m1/s1 |
| InChIKey | AHDUWGQSZYSNEY-HUOCPXEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabraleahydroxylactone (CHEBI:70269) has role plant metabolite (CHEBI:76924) |
| cabraleahydroxylactone (CHEBI:70269) is a secondary alcohol (CHEBI:35681) |
| cabraleahydroxylactone (CHEBI:70269) is a tetracyclic triterpenoid (CHEBI:26893) |
| cabraleahydroxylactone (CHEBI:70269) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3α,5α)-3-hydroxy-4,4,8,14-tetramethyl-20,24-epoxy-18-norcholan-24-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1628323 | Reaxys |
| Citations |
|---|