EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54O5 |
| Net Charge | 0 |
| Average Mass | 518.779 |
| Monoisotopic Mass | 518.39712 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]([H])([C@@](C)(O)C/C=C/C(C)(C)OO)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C32H54O5/c1-21(33)36-26-15-18-29(6)24(28(26,4)5)14-20-31(8)25(29)12-11-22-23(13-19-30(22,31)7)32(9,34)17-10-16-27(2,3)37-35/h10,16,22-26,34-35H,11-15,17-20H2,1-9H3/b16-10+/t22-,23+,24+,25-,26-,29+,30-,31-,32+/m1/s1 |
| InChIKey | DHINOQSEHVSVIQ-XWYOUNHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aglaiabbreviatin F (CHEBI:70267) has role antineoplastic agent (CHEBI:35610) |
| aglaiabbreviatin F (CHEBI:70267) has role plant metabolite (CHEBI:76924) |
| aglaiabbreviatin F (CHEBI:70267) is a acetate ester (CHEBI:47622) |
| aglaiabbreviatin F (CHEBI:70267) is a peroxol (CHEBI:35924) |
| aglaiabbreviatin F (CHEBI:70267) is a tertiary alcohol (CHEBI:26878) |
| aglaiabbreviatin F (CHEBI:70267) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| rel-(3R,5R,8R,9R,10R,13R,14R,17S)-17-[(2S,4E)-6-hydroperoxy-2-hydroxy-6-methylhept-4-en-2-yl]-4,4,8,10,14-pentamethylhexadecahydro-1H-cyclopenta[a]phenanthren-3-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21155751 | Reaxys |
| Citations |
|---|