EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@]3([H])C(=C)C/C=C/C(C)(C)O)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H48O2/c1-20(10-9-16-26(2,3)32)21-13-18-29(7)22(21)11-12-24-28(6)17-15-25(31)27(4,5)23(28)14-19-30(24,29)8/h9,16,21-24,32H,1,10-15,17-19H2,2-8H3/b16-9+/t21-,22-,23+,24-,28+,29-,30-/m1/s1 |
| InChIKey | UEMOSIMEJKJGBC-MBMJWOSHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aglaiabbreviatin E (CHEBI:70266) has role plant metabolite (CHEBI:76924) |
| aglaiabbreviatin E (CHEBI:70266) is a cyclic terpene ketone (CHEBI:36130) |
| aglaiabbreviatin E (CHEBI:70266) is a tertiary alcohol (CHEBI:26878) |
| aglaiabbreviatin E (CHEBI:70266) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| rel-(5R,8R,9R,10R,13R,14R,17S)-17-[(4E)-6-hydroxy-6-methylhepta-1,4-dien-2-yl]-4,4,8,10,14-pentamethylhexadecahydro-3H-cyclopenta[a]phenanthren-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21155750 | Reaxys |
| Citations |
|---|