EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]([H])([C@]4(C)CC=CC(C)(C)O4)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H48O2/c1-25(2)15-9-16-30(8,32-25)21-12-18-28(6)20(21)10-11-23-27(5)17-14-24(31)26(3,4)22(27)13-19-29(23,28)7/h9,15,20-23H,10-14,16-19H2,1-8H3/t20-,21+,22+,23-,27+,28-,29-,30+/m1/s1 |
| InChIKey | WVWUAJRNIVNQJF-MRULXVATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aglaiabbreviatin D (CHEBI:70265) has role plant metabolite (CHEBI:76924) |
| aglaiabbreviatin D (CHEBI:70265) is a cyclic terpene ketone (CHEBI:36130) |
| aglaiabbreviatin D (CHEBI:70265) is a pyrans (CHEBI:26407) |
| aglaiabbreviatin D (CHEBI:70265) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (5R,8R,9R,10R,13R,14R,17S)-4,4,8,10,14-pentamethyl-17-[(2S)-2,6,6-trimethyl-3,6-dihydro-2H-pyran-2-yl]hexadecahydro-3H-cyclopenta[a]phenanthren-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21155748 | Reaxys |
| Citations |
|---|