EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O2 |
| Net Charge | 0 |
| Average Mass | 360.582 |
| Monoisotopic Mass | 360.30283 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@H](C(C)=O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C24H40O2/c1-15(25)16-9-13-23(5)17(16)7-8-19-22(4)12-11-20(26)21(2,3)18(22)10-14-24(19,23)6/h16-20,26H,7-14H2,1-6H3/t16-,17-,18+,19-,20-,22+,23-,24-/m1/s1 |
| InChIKey | GRVOAMBHUWXGTO-NICZXZAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aglaiabbreviatin C (CHEBI:70264) has role plant metabolite (CHEBI:76924) |
| aglaiabbreviatin C (CHEBI:70264) is a methyl ketone (CHEBI:51867) |
| aglaiabbreviatin C (CHEBI:70264) is a secondary alcohol (CHEBI:35681) |
| aglaiabbreviatin C (CHEBI:70264) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3α,5α)-3-hydroxy-4,4,8,14-tetramethyl-18-norpregnan-20-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21155743 | Reaxys |
| Citations |
|---|