EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24O10 |
| Net Charge | 0 |
| Average Mass | 496.468 |
| Monoisotopic Mass | 496.13695 |
| SMILES | COc1cc([C@H]2CC(=O)Oc3c4c(cc(O)c32)O[C@H](c2cc(O)c(OC)c(O)c2)[C@@H](O)C4)ccc1O |
| InChI | InChI=1S/C26H24O10/c1-33-21-7-11(3-4-15(21)27)13-9-22(32)36-25-14-8-19(31)24(35-20(14)10-16(28)23(13)25)12-5-17(29)26(34-2)18(30)6-12/h3-7,10,13,19,24,27-31H,8-9H2,1-2H3/t13-,19+,24-/m1/s1 |
| InChIKey | HYDZYHSPOSOKQM-ZXWJAXLNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21080642) | Ethanolic extract of air-dried, powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4',3''-di-O-methylapocynin-D (CHEBI:70260) has role metabolite (CHEBI:25212) |
| 4',3''-di-O-methylapocynin-D (CHEBI:70260) is a catechin (CHEBI:23053) |
| Citations |
|---|