EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20O10 |
| Net Charge | 0 |
| Average Mass | 456.403 |
| Monoisotopic Mass | 456.10565 |
| SMILES | COc1ccc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2OC(=O)c2cc(O)c(O)c(O)c2)cc1O |
| InChI | InChI=1S/C23H20O10/c1-31-18-3-2-10(4-15(18)26)22-20(9-13-14(25)7-12(24)8-19(13)32-22)33-23(30)11-5-16(27)21(29)17(28)6-11/h2-8,20,22,24-29H,9H2,1H3/t20-,22-/m1/s1 |
| InChIKey | CEXLPAFKWSVHSK-IFMALSPDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21080642) | Ethanolic extract of air-dried, powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-methylepicatechin-3-O-gallate (CHEBI:70257) has role metabolite (CHEBI:25212) |
| 4'-O-methylepicatechin-3-O-gallate (CHEBI:70257) is a catechin (CHEBI:23053) |
| Citations |
|---|