EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O7 |
| Net Charge | 0 |
| Average Mass | 320.297 |
| Monoisotopic Mass | 320.08960 |
| SMILES | COc1c(O)cc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)cc1O |
| InChI | InChI=1S/C16H16O7/c1-22-16-11(19)2-7(3-12(16)20)15-13(21)6-9-10(18)4-8(17)5-14(9)23-15/h2-5,13,15,17-21H,6H2,1H3/t13-,15-/m1/s1 |
| InChIKey | ITDYPNOEEHONAH-UKRRQHHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21080642) | Ethanolic extract of air-dried, powdered bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-methylepigallocatechin (CHEBI:70253) has role metabolite (CHEBI:25212) |
| 4'-O-methylepigallocatechin (CHEBI:70253) is a catechin (CHEBI:23053) |
| Synonyms | Source |
|---|---|
| (2R,3R)-2-(3,5-dihydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol | ChEBI |
| Ourateacatechin | ChEBI |
| Citations |
|---|