EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H54O8 |
| Net Charge | 0 |
| Average Mass | 602.809 |
| Monoisotopic Mass | 602.38187 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@]34C[C@]35CC[C@]3(C)[C@@]6([H])[C@H](C)C[C@@]7([H])O[C@@]6(O[C@@H]7C(=C)C)[C@H](O)[C@@]3(C)[C@]5([H])CC[C@@]4([H])C2(C)C)OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C35H54O8/c1-17(2)26-20-14-18(3)27-31(6)12-13-34-16-33(34)11-10-23(41-28-25(38)24(37)19(36)15-40-28)30(4,5)21(33)8-9-22(34)32(31,7)29(39)35(27,42-20)43-26/h18-29,36-39H,1,8-16H2,2-7H3/t18-,19-,20-,21+,22+,23+,24+,25-,26-,27-,28+,29-,31-,32-,33-,34+,35+/m1/s1 |
| InChIKey | CVBALRXHSITZGC-PVGNLWKZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actaea racemosa (ncbitaxon:64040) | rhizome (BTO:0001181) | PubMed (21082802) | Methanolic extract of dried, ground rhizomes |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25-O-anhydrocimigenol 3-O-beta-D-xylopyranoside (CHEBI:70250) has role metabolite (CHEBI:25212) |
| 25-O-anhydrocimigenol 3-O-beta-D-xylopyranoside (CHEBI:70250) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|