EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H58O11 |
| Net Charge | 0 |
| Average Mass | 678.860 |
| Monoisotopic Mass | 678.39791 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@]34C[C@]35C[C@@H](OC(C)=O)[C@]3(C)[C@@]6([H])[C@H](C)C[C@@]7([H])O[C@@]6(O[C@@H]7C(C)(C)O)[C@H](O)[C@@]3(C)[C@]5([H])CC[C@@]4([H])C2(C)C)OC[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C37H58O11/c1-17-13-20-28(32(5,6)43)48-37(47-20)27(17)34(8)24(45-18(2)38)14-36-16-35(36)12-11-23(46-29-26(41)25(40)19(39)15-44-29)31(3,4)21(35)9-10-22(36)33(34,7)30(37)42/h17,19-30,39-43H,9-16H2,1-8H3/t17-,19+,20-,21+,22+,23+,24-,25+,26-,27-,28+,29+,30-,33-,34-,35-,36+,37+/m1/s1 |
| InChIKey | HZIBYJCDCHVSPK-RKUDFBBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actaea racemosa (ncbitaxon:64040) | rhizome (BTO:0001181) | PubMed (21082802) | Methanolic extract of dried, ground rhizomes |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cimiracemoside D (CHEBI:70247) has role metabolite (CHEBI:25212) |
| Cimiracemoside D (CHEBI:70247) is a cucurbitacin (CHEBI:16219) |
| Cimiracemoside D (CHEBI:70247) is a glycoside (CHEBI:24400) |
| Manual Xrefs | Databases |
|---|---|
| 10242586 | ChemSpider |
| Citations |
|---|