EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H56O9 |
| Net Charge | 0 |
| Average Mass | 620.824 |
| Monoisotopic Mass | 620.39243 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@]34C[C@]35CC[C@]3(C)[C@@]6([H])[C@H](C)C[C@@]7([H])O[C@@]6(O[C@@H]7C(C)(C)O)[C@H](O)[C@@]3(C)[C@]5([H])CC[C@@]4([H])C2(C)C)OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C35H56O9/c1-17-14-19-26(30(4,5)40)44-35(43-19)25(17)31(6)12-13-34-16-33(34)11-10-22(42-27-24(38)23(37)18(36)15-41-27)29(2,3)20(33)8-9-21(34)32(31,7)28(35)39/h17-28,36-40H,8-16H2,1-7H3/t17-,18-,19-,20+,21+,22+,23+,24-,25-,26+,27+,28-,31-,32-,33-,34+,35+/m1/s1 |
| InChIKey | BTPYUWOBZFGKAI-XYGBCAHESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actaea racemosa (ncbitaxon:64040) | rhizome (BTO:0001181) | PubMed (21082802) | Methanolic extract of dried, ground rhizomes |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cimigenol 3-O-beta-D-xylopyranoside (CHEBI:70246) has role metabolite (CHEBI:25212) |
| Cimigenol 3-O-beta-D-xylopyranoside (CHEBI:70246) is a cucurbitacin (CHEBI:16219) |
| Cimigenol 3-O-beta-D-xylopyranoside (CHEBI:70246) is a glycoside (CHEBI:24400) |
| Citations |
|---|