EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H56O11 |
| Net Charge | 0 |
| Average Mass | 676.844 |
| Monoisotopic Mass | 676.38226 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@]34C[C@]35C[C@@H](OC(C)=O)[C@]3(C)[C@@]6([H])[C@H](C)[C@@]7([H])OC(C)(C)[C@@H](O)[C@@]7(O)O[C@@]6([H])C[C@@]3(C)C5=CC[C@@]4([H])C2(C)C)OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C37H56O11/c1-17-25-20(47-37(43)28(17)48-32(5,6)30(37)42)13-33(7)22-10-9-21-31(3,4)23(46-29-27(41)26(40)19(39)15-44-29)11-12-35(21)16-36(22,35)14-24(34(25,33)8)45-18(2)38/h10,17,19-21,23-30,39-43H,9,11-16H2,1-8H3/t17-,19+,20-,21-,23-,24+,25-,26-,27+,28+,29-,30+,33-,34+,35+,36-,37-/m0/s1 |
| InChIKey | IHMRHYCBRKQAFU-CCPRSJHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actaea racemosa (ncbitaxon:64040) | rhizome (BTO:0001181) | PubMed (21082802) | Methanolic extract of dried, ground rhizomes |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cimiracemoside F (CHEBI:70245) has role metabolite (CHEBI:25212) |
| Cimiracemoside F (CHEBI:70245) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|