EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O10 |
| Net Charge | 0 |
| Average Mass | 616.748 |
| Monoisotopic Mass | 616.32475 |
| SMILES | [H][C@@]12C[C@@H](OC(=O)/C=C\C=C\CCCCC)C=C3[C@@H](OC(C)=O)O[C@@H](OC(C)=O)[C@]31[C@@H](O)C[C@@H](C)[C@@]2(C)C[C@H](OO)C(=C)C=C |
| InChI | InChI=1S/C34H48O10/c1-8-10-11-12-13-14-15-16-30(38)42-25-18-26-31(40-23(5)35)43-32(41-24(6)36)34(26)28(19-25)33(7,22(4)17-29(34)37)20-27(44-39)21(3)9-2/h9,13-16,18,22,25,27-29,31-32,37,39H,2-3,8,10-12,17,19-20H2,1,4-7H3/b14-13+,16-15-/t22-,25+,27+,28+,29+,31+,32-,33-,34-/m1/s1 |
| InChIKey | HXZWRWDSAJYAQI-NLYZPZRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Casearia arguta (ncbitaxon:1125347) | leaf (BTO:0000713) | PubMed (21067210) | Combined extract of DCM/MeOH (1:1) and methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Argutin F (CHEBI:70237) has role metabolite (CHEBI:25212) |
| Argutin F (CHEBI:70237) is a naphthofuran (CHEBI:39270) |
| Synonym | Source |
|---|---|
| (2R,5S,6S,8R,9R,10S,12S,18R,19S)-18,19-diacetoxy-18,19-epoxy-2-[(2'Z,4'E)-decadienoyloxy]6-hydroxy-12-hydroperoxycleroda-3,13(16),14-triene | ChEBI |
| Citations |
|---|