EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O9 |
| Net Charge | 0 |
| Average Mass | 600.749 |
| Monoisotopic Mass | 600.32983 |
| SMILES | [H][C@@]12C[C@@H](OC(=O)/C=C\C=C\CCCCC)C=C3[C@@H](OC(C)=O)O[C@@H](OC(C)=O)[C@]31[C@H](O)[C@H](O)[C@@H](C)[C@@]2(C)C/C=C(\C)C=C |
| InChI | InChI=1S/C34H48O9/c1-8-10-11-12-13-14-15-16-28(37)42-25-19-26-31(40-23(5)35)43-32(41-24(6)36)34(26)27(20-25)33(7,18-17-21(3)9-2)22(4)29(38)30(34)39/h9,13-17,19,22,25,27,29-32,38-39H,2,8,10-12,18,20H2,1,3-7H3/b14-13+,16-15-,21-17+/t22-,25+,27+,29-,30-,31+,32-,33-,34-/m1/s1 |
| InChIKey | SYVLIZAFBWNVCK-DEHQYFKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Casearia arguta (ncbitaxon:1125347) | leaf (BTO:0000713) | PubMed (21067210) | Combined extract of DCM/MeOH (1:1) and methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Argutin C (CHEBI:70234) has role metabolite (CHEBI:25212) |
| Argutin C (CHEBI:70234) is a naphthofuran (CHEBI:39270) |
| Synonym | Source |
|---|---|
| (2R,5S,6S,7R,8S,9S,10S,18R,19S)-18,19-diacetoxy-18,19-epoxy-2-[(2'Z,4'E)-decadienoyloxy)-6,7-dihydroxy]cleroda-3,12(E),14-triene | ChEBI |
| Citations |
|---|