EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O5 |
| Net Charge | 0 |
| Average Mass | 369.377 |
| Monoisotopic Mass | 369.13247 |
| SMILES | COC(=O)CC(O)N(C)C(=O)c1cc2c(nc3ccccc32)c(C(C)=O)n1 |
| InChI | InChI=1S/C19H19N3O5/c1-10(23)17-18-12(11-6-4-5-7-13(11)20-18)8-14(21-17)19(26)22(2)15(24)9-16(25)27-3/h4-8,15,20,24H,9H2,1-3H3 |
| InChIKey | RBWSIWUGQOJFGB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stellaria dichotoma var. lanceolata (IPNI:50920984-1) | root (BTO:0001188) | PubMed (21090796) | Methanolic extract of air-dried, powdered roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dichotomide XI (CHEBI:70219) has role metabolite (CHEBI:25212) |
| Dichotomide XI (CHEBI:70219) is a harmala alkaloid (CHEBI:61379) |
| Synonym | Source |
|---|---|
| methyl 3-[(1-acetyl-9H-pyrido[3,4-b]indole-3-carbonyl)-methylamino]-3-hydroxypropanoate | ChEBI |
| Citations |
|---|