EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25N3O10 |
| Net Charge | 0 |
| Average Mass | 515.475 |
| Monoisotopic Mass | 515.15399 |
| SMILES | COC(=O)/C=C/NC(=O)c1cc2c(nc3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cccc32)c(C(C)=O)n1 |
| InChI | InChI=1S/C24H25N3O10/c1-10(29)17-19-12(8-13(26-17)23(34)25-7-6-16(30)35-2)11-4-3-5-14(18(11)27-19)36-24-22(33)21(32)20(31)15(9-28)37-24/h3-8,15,20-22,24,27-28,31-33H,9H2,1-2H3,(H,25,34)/b7-6+/t15-,20-,21+,22-,24-/m1/s1 |
| InChIKey | UMGPWCXTJXKPHK-INDRKVQXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stellaria dichotoma var. lanceolata (IPNI:50920984-1) | root (BTO:0001188) | PubMed (21090796) | Methanolic extract of air-dried, powdered roots |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichotomide IV (CHEBI:70212) has role plant metabolite (CHEBI:76924) |
| dichotomide IV (CHEBI:70212) is a aromatic ketone (CHEBI:76224) |
| dichotomide IV (CHEBI:70212) is a enoate ester (CHEBI:51702) |
| dichotomide IV (CHEBI:70212) is a methyl ester (CHEBI:25248) |
| dichotomide IV (CHEBI:70212) is a monocarboxylic acid amide (CHEBI:29347) |
| dichotomide IV (CHEBI:70212) is a monosaccharide derivative (CHEBI:63367) |
| dichotomide IV (CHEBI:70212) is a organic heterotricyclic compound (CHEBI:26979) |
| dichotomide IV (CHEBI:70212) is a β-D-glucoside (CHEBI:22798) |
| dichotomide IV (CHEBI:70212) is a β-carboline alkaloid (CHEBI:83325) |
| IUPAC Name |
|---|
| methyl (2E)-3-{[(1-acetyl-8-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy}-9H-β-carbolin-3-yl)carbonyl]amino}prop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21155703 | Reaxys |
| Citations |
|---|