EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48N8O9 |
| Net Charge | 0 |
| Average Mass | 712.805 |
| Monoisotopic Mass | 712.35443 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](Cc2cnc3ccccc23)NC(=O)[C@H](CO)NC(=O)[C@@H]2CCCN2C(=O)[C@H]([C@@H](C)O)NC(=O)CNC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C34H48N8O9/c1-17(2)12-23-30(47)37-18(3)29(46)36-15-27(45)41-28(19(4)44)34(51)42-11-7-10-26(42)33(50)40-25(16-43)32(49)39-24(31(48)38-23)13-20-14-35-22-9-6-5-8-21(20)22/h5-6,8-9,14,17-19,23-26,28,35,43-44H,7,10-13,15-16H2,1-4H3,(H,36,46)(H,37,47)(H,38,48)(H,39,49)(H,40,50)(H,41,45)/t18-,19+,23-,24-,25-,26-,28-/m0/s1 |
| InChIKey | WKYUAYAMTGFDMV-VAFKGHBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psammosilene tunicoides (ncbitaxon:39860) | root (BTO:0001188) | PubMed (21070025) | 80% alcoholic extract of air-dried, powdered roots |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tunicyclin C (CHEBI:70208) has role metabolite (CHEBI:25212) |
| Tunicyclin C (CHEBI:70208) is a cyclic peptide (CHEBI:23449) |
| Synonym | Source |
|---|---|
| cyclo-(L-Pro-L-Ser-L-Trp-L-Leu-L-Ala-Gly-L-Thr) | ChEBI |
| Citations |
|---|