EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H48N8O9 |
| Net Charge | 0 |
| Average Mass | 724.816 |
| Monoisotopic Mass | 724.35443 |
| SMILES | CC(C)C[C@@H]1NC(=O)/C(=C/c2cnc3ccccc23)NC(=O)[C@H](CO)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C35H48N8O9/c1-18(2)12-23-31(48)42-29(19(3)4)34(51)37-15-28(46)38-26(17-45)35(52)43-11-7-10-27(43)33(50)41-25(16-44)32(49)40-24(30(47)39-23)13-20-14-36-22-9-6-5-8-21(20)22/h5-6,8-9,13-14,18-19,23,25-27,29,36,44-45H,7,10-12,15-17H2,1-4H3,(H,37,51)(H,38,46)(H,39,47)(H,40,49)(H,41,50)(H,42,48)/b24-13-/t23-,25-,26-,27-,29-/m0/s1 |
| InChIKey | GLZHBDNWBMMQBD-BKTPBXFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psammosilene tunicoides (ncbitaxon:39860) | root (BTO:0001188) | PubMed (21070025) | 80% alcoholic extract of air-dried, powdered roots |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tunicyclin B (CHEBI:70207) has role metabolite (CHEBI:25212) |
| Tunicyclin B (CHEBI:70207) is a cyclic peptide (CHEBI:23449) |
| Synonym | Source |
|---|---|
| cyclo-(L-Pro-L-Ser-deltaZ-Trp-L-Leu-L-Val-Gly-L-Ser) | ChEBI |
| Citations |
|---|