EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O15 |
| Net Charge | 0 |
| Average Mass | 608.549 |
| Monoisotopic Mass | 608.17412 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2c2c(O)cc(O)c3c(=O)cc(-c4ccc(O)c(OC)c4)oc23)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C28H32O15/c1-9-20(34)22(36)24(38)28(40-9)43-27-23(37)21(35)17(8-29)42-26(27)19-13(32)6-12(31)18-14(33)7-15(41-25(18)19)10-3-4-11(30)16(5-10)39-2/h3-7,9,17,20-24,26-32,34-38H,8H2,1-2H3/t9-,17+,20-,21+,22+,23-,24+,26-,27+,28-/m0/s1 |
| InChIKey | UBWXCUKKZPNFTJ-VVVHOGNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrorhagia velutina (ncbitaxon:308175) | |||
| root (BTO:0001188) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| leaf (BTO:0000713) | PubMed (21080643) | Methanolic extract of dried leaf and root |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2''-O-rhamnosylscoparin (CHEBI:70204) has role plant metabolite (CHEBI:76924) |
| 2''-O-rhamnosylscoparin (CHEBI:70204) is a disaccharide derivative (CHEBI:63353) |
| 2''-O-rhamnosylscoparin (CHEBI:70204) is a flavone C-glycoside (CHEBI:83280) |
| 2''-O-rhamnosylscoparin (CHEBI:70204) is a monomethoxyflavone (CHEBI:25401) |
| 2''-O-rhamnosylscoparin (CHEBI:70204) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-2-O-(6-deoxy-α-L-mannopyranosyl)-1-[5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol |
| Citations |
|---|