EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O14 |
| Net Charge | 0 |
| Average Mass | 566.512 |
| Monoisotopic Mass | 566.16356 |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)Oc2c1c(O)cc(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c2[C@@H]1OC[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H30O14/c27-7-16-20(33)21(34)23(36)26(40-16)39-15-6-12(30)17-11(29)5-14(9-1-3-10(28)4-2-9)38-24(17)18(15)25-22(35)19(32)13(31)8-37-25/h1-4,6,13-14,16,19-23,25-28,30-36H,5,7-8H2/t13-,14-,16+,19-,20+,21-,22+,23+,25-,26+/m0/s1 |
| InChIKey | XNXNAVGWFAPTIB-AGZCJXADSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petrorhagia velutina (ncbitaxon:308175) | |||
| root (BTO:0001188) | PubMed (21080643) | Methanolic extract of dried leaf and root | |
| leaf (BTO:0000713) | PubMed (21080643) | Methanolic extract of dried leaf and root |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-C-α-L-arabinopyranosyl-7-O-β-D-glucopyranosylnaringenin (CHEBI:70200) has functional parent (S)-naringenin (CHEBI:17846) |
| 8-C-α-L-arabinopyranosyl-7-O-β-D-glucopyranosylnaringenin (CHEBI:70200) has role plant metabolite (CHEBI:76924) |
| 8-C-α-L-arabinopyranosyl-7-O-β-D-glucopyranosylnaringenin (CHEBI:70200) is a (2S)-flavan-4-one (CHEBI:140377) |
| 8-C-α-L-arabinopyranosyl-7-O-β-D-glucopyranosylnaringenin (CHEBI:70200) is a dihydroxyflavone (CHEBI:38686) |
| 8-C-α-L-arabinopyranosyl-7-O-β-D-glucopyranosylnaringenin (CHEBI:70200) is a flavone C-glycoside (CHEBI:83280) |
| 8-C-α-L-arabinopyranosyl-7-O-β-D-glucopyranosylnaringenin (CHEBI:70200) is a glycosyloxyflavone (CHEBI:50018) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[(2S)-7-(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-8-yl]-L-arabinitol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21148645 | Reaxys |
| Citations |
|---|