EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | COc1cc([C@@H]2Oc3cc(CCCO)ccc3O[C@H]2CO)ccc1O |
| InChI | InChI=1S/C19H22O6/c1-23-16-10-13(5-6-14(16)22)19-18(11-21)24-15-7-4-12(3-2-8-20)9-17(15)25-19/h4-7,9-10,18-22H,2-3,8,11H2,1H3/t18-,19-/m0/s1 |
| InChIKey | VSJGYMSTWHUFMX-OALUTQOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus yunnanensis (ncbitaxon:147275) | xylem (BTO:0001468) | PubMed (21138310) | Previous component: wood; Aqueous extract of air-dried, powdered wood |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7S,8S)-methoxy-3',7-epoxy-8,4'-oxyneolignan-4,9,9'-triol (CHEBI:70198) has role plant metabolite (CHEBI:76924) |
| (7S,8S)-methoxy-3',7-epoxy-8,4'-oxyneolignan-4,9,9'-triol (CHEBI:70198) is a guaiacols (CHEBI:134251) |
| (7S,8S)-methoxy-3',7-epoxy-8,4'-oxyneolignan-4,9,9'-triol (CHEBI:70198) is a neolignan (CHEBI:25497) |
| (7S,8S)-methoxy-3',7-epoxy-8,4'-oxyneolignan-4,9,9'-triol (CHEBI:70198) is a oxacycle (CHEBI:38104) |
| (7S,8S)-methoxy-3',7-epoxy-8,4'-oxyneolignan-4,9,9'-triol (CHEBI:70198) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 4-[(2S,3S)-3-(hydroxymethyl)-7-(3-hydroxypropyl)-2,3-dihydro-1,4-benzodioxin-2-yl]-2-methoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5856696 | Reaxys |
| Citations |
|---|