EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O7 |
| Net Charge | 0 |
| Average Mass | 376.405 |
| Monoisotopic Mass | 376.15220 |
| SMILES | [H][C@@]1([C@H](O)c2ccc(O)c(OC)c2)CO[C@H](c2ccc(O)c(OC)c2)[C@H]1CO |
| InChI | InChI=1S/C20H24O7/c1-25-17-7-11(3-5-15(17)22)19(24)14-10-27-20(13(14)9-21)12-4-6-16(23)18(8-12)26-2/h3-8,13-14,19-24H,9-10H2,1-2H3/t13-,14+,19+,20+/m0/s1 |
| InChIKey | MWQRAOGWLXTMIC-TUGJPZLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus yunnanensis (ncbitaxon:147275) | xylem (BTO:0001468) | PubMed (21138310) | Previous component: wood; Aqueous extract of air-dried, powdered wood |
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tanegool (CHEBI:70196) has role plant metabolite (CHEBI:76924) |
| tanegool (CHEBI:70196) is a guaiacols (CHEBI:134251) |
| tanegool (CHEBI:70196) is a lignan (CHEBI:25036) |
| tanegool (CHEBI:70196) is a oxolane (CHEBI:26911) |
| tanegool (CHEBI:70196) is a polyphenol (CHEBI:26195) |
| tanegool (CHEBI:70196) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 4-{(S)-hydroxy[(3S,4R,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-(hydroxymethyl)tetrahydrofuran-3-yl]methyl}-2-methoxyphenol |
| Synonym | Source |
|---|---|
| (7S,8R,7'S,8'S)-4,4',9,7'-tetrahydroxy-3,3'-dimethoxy-7,9'-epoxylignan | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4300905 | Reaxys |
| Citations |
|---|