EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | COc1cc2c(cc1O)[C@H](c1ccc(O)c(O)c1)[C@@H](CO)[C@H](CO)C2 |
| InChI | InChI=1S/C19H22O6/c1-25-18-6-11-4-12(8-20)14(9-21)19(13(11)7-17(18)24)10-2-3-15(22)16(23)5-10/h2-3,5-7,12,14,19-24H,4,8-9H2,1H3/t12-,14-,19-/m0/s1 |
| InChIKey | GQLVRVYXAHDDLB-PJFSTRORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus yunnanensis (ncbitaxon:147275) | xylem (BTO:0001468) | PubMed (21138310) | Previous component: wood; Aqueous extract of air-dried, powdered wood |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isotaxiresinol (CHEBI:70194) has role plant metabolite (CHEBI:76924) |
| isotaxiresinol (CHEBI:70194) is a lignan (CHEBI:25036) |
| isotaxiresinol (CHEBI:70194) is a pentol (CHEBI:37205) |
| isotaxiresinol (CHEBI:70194) is a polyphenol (CHEBI:26195) |
| isotaxiresinol (CHEBI:70194) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 4-[(1S,2R,3R)-7-hydroxy-2,3-bis(hydroxymethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]benzene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2631782 | Reaxys |
| Citations |
|---|