EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O7 |
| Net Charge | 0 |
| Average Mass | 362.378 |
| Monoisotopic Mass | 362.13655 |
| SMILES | [H][C@]1([C@@H](O)c2ccc(O)c(OC)c2)CO[C@H](c2ccc(O)c(O)c2)[C@H]1CO |
| InChI | InChI=1S/C19H22O7/c1-25-17-7-10(2-5-15(17)22)18(24)13-9-26-19(12(13)8-20)11-3-4-14(21)16(23)6-11/h2-7,12-13,18-24H,8-9H2,1H3/t12-,13-,18-,19+/m0/s1 |
| InChIKey | PMALFGMVFUCPMK-BIPCEHGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus yunnanensis (ncbitaxon:147275) | xylem (BTO:0001468) | PubMed (21138310) | Previous component: wood; Aqueous extract of air-dried, powdered wood |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7R)-7-hydroxytaxiresinol (CHEBI:70193) has role plant metabolite (CHEBI:76924) |
| (7R)-7-hydroxytaxiresinol (CHEBI:70193) is a guaiacols (CHEBI:134251) |
| (7R)-7-hydroxytaxiresinol (CHEBI:70193) is a lignan (CHEBI:25036) |
| (7R)-7-hydroxytaxiresinol (CHEBI:70193) is a oxolanes (CHEBI:26912) |
| (7R)-7-hydroxytaxiresinol (CHEBI:70193) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4-[(2S,3R,4R)-4-[(R)-hydroxy(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)tetrahydrofuran-2-yl]benzene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21220935 | Reaxys |
| Citations |
|---|