EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | COc1ccc2c(c1)[C@H](O)[C@@H](c1ccc(O)c(OC)c1)CO2 |
| InChI | InChI=1S/C17H18O5/c1-20-11-4-6-15-12(8-11)17(19)13(9-22-15)10-3-5-14(18)16(7-10)21-2/h3-8,13,17-19H,9H2,1-2H3/t13-,17+/m1/s1 |
| InChIKey | ZBKQJCCSUWZZQH-DYVFJYSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus yunnanensis (ncbitaxon:147275) | xylem (BTO:0001468) | PubMed (21138310) | Previous component: wood; Aqueous extract of air-dried, powdered wood |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,4R)-4' hydroxy-6,3' dimethoxyisoflavan-4-ol (CHEBI:70191) has functional parent (S)-isoflavan (CHEBI:36100) |
| (3S,4R)-4' hydroxy-6,3' dimethoxyisoflavan-4-ol (CHEBI:70191) has role plant metabolite (CHEBI:76924) |
| (3S,4R)-4' hydroxy-6,3' dimethoxyisoflavan-4-ol (CHEBI:70191) is a hydroxyisoflavans (CHEBI:76250) |
| (3S,4R)-4' hydroxy-6,3' dimethoxyisoflavan-4-ol (CHEBI:70191) is a methoxyisoflavan (CHEBI:77002) |
| IUPAC Name |
|---|
| (3S,4R)-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21220934 | Reaxys |
| Citations |
|---|