EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O4 |
| Net Charge | 0 |
| Average Mass | 424.581 |
| Monoisotopic Mass | 424.26136 |
| SMILES | CC(C)=CCC/C(=C\CC/C(C)=C/CC[C@]1(C)C=Cc2cc(O)cc(C)c2O1)C(=O)O |
| InChI | InChI=1S/C27H36O4/c1-19(2)9-6-12-22(26(29)30)13-7-10-20(3)11-8-15-27(5)16-14-23-18-24(28)17-21(4)25(23)31-27/h9,11,13-14,16-18,28H,6-8,10,12,15H2,1-5H3,(H,29,30)/b20-11+,22-13+/t27-/m1/s1 |
| InChIKey | QKXAGRZCXAYBQX-IGRQAULMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryllus tuberatus (WORMS:250109) | - | PubMed (21142112) | Frozen, lyophilized, dried extract of specimen in 50% methanol in dichloromethane |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-Sargachromenol (CHEBI:70189) has role metabolite (CHEBI:25212) |
| (R)-Sargachromenol (CHEBI:70189) is a tocotrienol (CHEBI:33235) |
| Citations |
|---|