EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34O4 |
| Net Charge | 0 |
| Average Mass | 422.565 |
| Monoisotopic Mass | 422.24571 |
| SMILES | CC(C)=CCCC1=C[C@@H](C/C(C)=C/CC[C@@]2(C)C=Cc3cc(O)cc(C)c3O2)OC1=O |
| InChI | InChI=1S/C27H34O4/c1-18(2)8-6-10-22-17-24(30-26(22)29)14-19(3)9-7-12-27(5)13-11-21-16-23(28)15-20(4)25(21)31-27/h8-9,11,13,15-17,24,28H,6-7,10,12,14H2,1-5H3/b19-9+/t24-,27+/m1/s1 |
| InChIKey | BNWXBVSPPVIYFO-LSJFATALSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryllus tuberatus (WORMS:250109) | - | PubMed (21142112) | Frozen, lyophilized, dried extract of specimen in 50% methanol in dichloromethane |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tuberatolide B (CHEBI:70186) has role metabolite (CHEBI:25212) |
| Tuberatolide B (CHEBI:70186) is a diterpene lactone (CHEBI:49193) |
| Synonym | Source |
|---|---|
| (2R)-2-[(E)-5-[(2S)-6-hydroxy-2,8-dimethylchromen-2-yl]-2-methylpent-2-enyl]-4-(4-methylpent-3-enyl)-2H-furan-5-one | ChEBI |
| Citations |
|---|