EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O3 |
| Net Charge | 0 |
| Average Mass | 290.403 |
| Monoisotopic Mass | 290.18819 |
| SMILES | CC(=O)CC/C=C(\C)C[C@@H]1C=C(CCC=C(C)C)C(=O)O1 |
| InChI | InChI=1S/C18H26O3/c1-13(2)7-5-10-16-12-17(21-18(16)20)11-14(3)8-6-9-15(4)19/h7-8,12,17H,5-6,9-11H2,1-4H3/b14-8+/t17-/m1/s1 |
| InChIKey | HPYAKDUQYJHSJJ-LEHPZIBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryllus tuberatus (WORMS:250109) | - | PubMed (21142112) | Frozen, lyophilized, dried extract of specimen in 50% methanol in dichloromethane |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tuberatolide A (CHEBI:70185) has role metabolite (CHEBI:25212) |
| Tuberatolide A (CHEBI:70185) is a diterpene lactone (CHEBI:49193) |
| Synonym | Source |
|---|---|
| (2R)-2-[(E)-2-methyl-6-oxohept-2-enyl]-4-(4-methylpent-3-enyl)-2H-furan-5-one | ChEBI |
| Citations |
|---|