EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO5 |
| Net Charge | 0 |
| Average Mass | 439.552 |
| Monoisotopic Mass | 439.23587 |
| SMILES | CC[C@@H](C)C[C@@H](C)/C=C(C)/C=C/C=C/C(O)=C1\C(=O)NC(C(O)c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C26H33NO5/c1-5-16(2)14-18(4)15-17(3)8-6-7-9-21(29)22-25(31)23(27-26(22)32)24(30)19-10-12-20(28)13-11-19/h6-13,15-16,18,23-24,28-30H,5,14H2,1-4H3,(H,27,32)/b8-6+,9-7+,17-15+,22-21+/t16-,18-,23?,24?/m1/s1 |
| InChIKey | NKHVQSJVSMTQID-YNUTZCEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria farinosa (ncbitaxon:89141) | - | PubMed (21158423) | EtOAc extract of fermented material of fungus inhabiting fruiting bodieds of Cordyceps sinensis |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| militarinone B (CHEBI:70184) has role metabolite (CHEBI:25212) |
| militarinone B (CHEBI:70184) is a monoterpenoid (CHEBI:25409) |
| Synonyms | Source |
|---|---|
| Militarinone B | KEGG COMPOUND |
| (3E)-5-[hydroxy-(4-hydroxyphenyl)methyl]-3-[(2E,4E,6E,8R,10R)-1-hydroxy-6,8,10-trimethyldodeca-2,4,6-trienylidene]pyrrolidine-2,4-dione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C12334 | KEGG COMPOUND |
| Citations |
|---|