EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O4 |
| Net Charge | 0 |
| Average Mass | 222.200 |
| Monoisotopic Mass | 222.06406 |
| SMILES | C/C(=N\Nc1ccccc1C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H10N2O4/c1-6(9(13)14)11-12-8-5-3-2-4-7(8)10(15)16/h2-5,12H,1H3,(H,13,14)(H,15,16)/b11-6+ |
| InChIKey | LYFFILJUMNENGO-IZZDOVSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria farinosa (ncbitaxon:89141) | - | PubMed (21158423) | EtOAc extract of fermented material of fungus inhabiting fruiting bodieds of Cordyceps sinensis |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Farylhydrazone B (CHEBI:70182) is a benzoic acids (CHEBI:22723) |
| Synonym | Source |
|---|---|
| 2-[(2E)-2-(1-carboxyethylidene)hydrazinyl]benzoic acid | ChEBI |
| Citations |
|---|