EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N3O5 |
| Net Charge | 0 |
| Average Mass | 279.252 |
| Monoisotopic Mass | 279.08552 |
| SMILES | C/C(=N\Nc1ccccc1C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H13N3O5/c1-7(11(18)13-6-10(16)17)14-15-9-5-3-2-4-8(9)12(19)20/h2-5,15H,6H2,1H3,(H,13,18)(H,16,17)(H,19,20)/b14-7+ |
| InChIKey | XWKNZWMZVKJEKJ-VGOFMYFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria farinosa (ncbitaxon:89141) | - | PubMed (21158423) | EtOAc extract of fermented material of fungus inhabiting fruiting bodieds of Cordyceps sinensis |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Farylhydrazone A (CHEBI:70181) has role metabolite (CHEBI:25212) |
| Farylhydrazone A (CHEBI:70181) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| 2-[(2E)-2-[1-(carboxymethylamino)-1-oxopropan-2-ylidene]hydrazinyl]benzoic acid | ChEBI |
| Citations |
|---|