EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35NO5 |
| Net Charge | 0 |
| Average Mass | 441.568 |
| Monoisotopic Mass | 441.25152 |
| SMILES | CC[C@@H](C)C[C@@H](C)/C=C(C)/C=C/C=C/C(=O)c1c(O)c(C23CCC(CC2)O3)cn(O)c1=O |
| InChI | InChI=1S/C26H35NO5/c1-5-17(2)14-19(4)15-18(3)8-6-7-9-22(28)23-24(29)21(16-27(31)25(23)30)26-12-10-20(32-26)11-13-26/h6-9,15-17,19-20,29,31H,5,10-14H2,1-4H3/b8-6+,9-7+,18-15+/t17-,19-,20?,26?/m1/s1 |
| InChIKey | HJCSSOXITDMEEP-ZUOACUPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria farinosa (ncbitaxon:89141) | - | PubMed (21158423) | EtOAc extract of fermented material of fungus inhabiting fruiting bodieds of Cordyceps sinensis |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Militarinone F, (rel)- (CHEBI:70180) has role metabolite (CHEBI:25212) |
| Militarinone F, (rel)- (CHEBI:70180) is a monoterpenoid (CHEBI:25409) |
| Synonym | Source |
|---|---|
| rel-1,4-dihydroxy-5-(7-oxabicyclo[2.2.1]heptan-4-yl)-3-[(2E,4E,6E,8R,10R)-6,8,10-trimethyldodeca-2,4,6-trienoyl]pyridin-2-one | ChEBI |
| Citations |
|---|