EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | [H][C@@]12CC3=C(C)C(=O)O[C@@]3(O)C[C@@]1(C)[C@H](O)CC[C@@]2(C)O |
| InChI | InChI=1S/C15H22O5/c1-8-9-6-10-13(2,7-15(9,19)20-12(8)17)11(16)4-5-14(10,3)18/h10-11,16,18-19H,4-7H2,1-3H3/t10-,11-,13-,14-,15+/m1/s1 |
| InChIKey | BWOFLNFAFOQHRS-BBIZWXPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21142110) | 95% ethanolic extract of whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chloraeudolide, (rel)- (CHEBI:70178) has role metabolite (CHEBI:25212) |
| Chloraeudolide, (rel)- (CHEBI:70178) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| rel-1beta,4alpha,8-trihydroxy-7(11)-eneudesm-8,12-olide | ChEBI |
| Citations |
|---|