EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H48O13 |
| Net Charge | 0 |
| Average Mass | 748.822 |
| Monoisotopic Mass | 748.30949 |
| SMILES | [H][C@]12C[C@@]1([H])[C@@]1(C)C(CC3=C(COC(=O)CCC(=O)OC)C(=O)O[C@]34[C@@]1([H])CC1=C3[C@@](C)([C@@H](O)C(=O)/C(=C(/C)C(=O)OC)[C@@]34[H])[C@]3([H])C[C@]13[H])[C@]2(O)COC(=O)/C(C)=C/C |
| InChI | InChI=1S/C41H48O13/c1-8-17(2)35(46)53-16-40(49)25-13-24(25)38(4)26(40)14-23-21(15-52-29(43)10-9-28(42)50-6)37(48)54-41(23)27(38)12-20-19-11-22(19)39(5)31(20)32(41)30(33(44)34(39)45)18(3)36(47)51-7/h8,19,22,24-27,32,34,45,49H,9-16H2,1-7H3/b17-8+,30-18-/t19-,22-,24-,25+,26?,27+,32+,34+,38+,39+,40+,41+/m1/s1 |
| InChIKey | XJVVFPZRUWTRKM-HMAJTNGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21142110) | 95% ethanolic extract of whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlorajaponol, (rel)- (CHEBI:70177) has role metabolite (CHEBI:25212) |
| Chlorajaponol, (rel)- (CHEBI:70177) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|