EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O8 |
| Net Charge | 0 |
| Average Mass | 408.447 |
| Monoisotopic Mass | 408.17842 |
| SMILES | [H][C@@]1(O[C@]23C[C@@]4(C)[C@]5([H])C[C@]5([H])C(=C)[C@]4([H])CC2=C(C)C(=O)O3)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H28O8/c1-8-10-4-13(10)20(3)7-21(12(5-11(8)20)9(2)18(26)28-21)29-19-17(25)16(24)15(23)14(6-22)27-19/h10-11,13-17,19,22-25H,1,4-7H2,2-3H3/t10-,11+,13-,14-,15-,16+,17-,19+,20-,21-/m1/s1 |
| InChIKey | DIHJSNVGGKCCRW-IFIACUTQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21142110) | 95% ethanolic extract of whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlorajaposide, (rel)- (CHEBI:70176) has role metabolite (CHEBI:25212) |
| Chlorajaposide, (rel)- (CHEBI:70176) is a glycoside (CHEBI:24400) |
| Synonym | Source |
|---|---|
| rel-(1alpha,3alpha)-8beta-glucopyranosyl-1H-lindan-4(15),7(11)-dien-12,8alpha-olide | ChEBI |
| Citations |
|---|