EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O4 |
| Net Charge | 0 |
| Average Mass | 260.289 |
| Monoisotopic Mass | 260.10486 |
| SMILES | [H][C@@]12O[C@H](O)C3=C1[C@@](C)(C[C@]1([H])OC(=O)C(C)=C21)[C@]1([H])C[C@]31[H] |
| InChI | InChI=1S/C15H16O4/c1-5-9-8(18-13(5)16)4-15(2)7-3-6(7)10-11(15)12(9)19-14(10)17/h6-8,12,14,17H,3-4H2,1-2H3/t6-,7+,8-,12-,14-,15-/m0/s1 |
| InChIKey | IIFNVNIPMCRQPC-YIEVAYSQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21142110) | 95% ethanolic extract of whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlorajapolide B, (rel)- (CHEBI:70172) has role metabolite (CHEBI:25212) |
| Chlorajapolide B, (rel)- (CHEBI:70172) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| rel-(1alpha,3alpha,6beta,8beta)-6,15-epoxy-15-hydroxy-1H-lindan-4,7(11)-dien-12,8alpha-olide | ChEBI |
| Citations |
|---|