EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H72N6O10 |
| Net Charge | 0 |
| Average Mass | 905.147 |
| Monoisotopic Mass | 904.53099 |
| SMILES | CCC[C@H]1OC(=O)[C@@H]2CCCN2C(=O)[C@H]([C@H](C)Cc2ccccc2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@H](C(C)C)OC(=O)[C@@H]2CCCN2C(=O)[C@H](C(C)C)NC(=O)C1(C)C |
| InChI | InChI=1S/C49H72N6O10/c1-9-17-37-49(7,8)48(63)51-38(29(2)3)43(58)54-26-16-23-36(54)47(62)65-40(30(4)5)45(60)53-25-14-21-34(53)42(57)52-24-13-20-33(52)41(56)50-39(31(6)28-32-18-11-10-12-19-32)44(59)55-27-15-22-35(55)46(61)64-37/h10-12,18-19,29-31,33-40H,9,13-17,20-28H2,1-8H3,(H,50,56)(H,51,63)/t31-,33+,34+,35+,36+,37-,38+,39+,40+/m1/s1 |
| InChIKey | GDQDVTDPOBTBOA-AVSCPADHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (21138309) | Ethyl acetate-Methanol (1:1) extract of freeze-dried organism |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pitiprolamide (CHEBI:70170) has role metabolite (CHEBI:25212) |
| Pitiprolamide (CHEBI:70170) is a cyclodepsipeptide (CHEBI:35213) |
| Citations |
|---|