EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13NO7 |
| Net Charge | 0 |
| Average Mass | 307.258 |
| Monoisotopic Mass | 307.06920 |
| SMILES | [H][C@@]12NC(=O)c3c(cc4c(c3O)OCO4)C1=C[C@H](O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C14H13NO7/c16-6-1-5-4-2-7-13(22-3-21-7)11(18)8(4)14(20)15-9(5)12(19)10(6)17/h1-2,6,9-10,12,16-19H,3H2,(H,15,20)/t6-,9+,10+,12-/m0/s1 |
| InChIKey | LZAZURSABQIKGB-AEKGRLRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Narcissus pseudonarcissus (ncbitaxon:39639) | bulb (BTO:0000159) | PubMed (21105682) | Isolated from freshly harvested bulbs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Narciclasine (CHEBI:70169) has role metabolite (CHEBI:25212) |
| Narciclasine (CHEBI:70169) is a phenanthridines (CHEBI:51245) |
| Synonyms | Source |
|---|---|
| (2S,3R,4S,4aR)-2,3,4,7-tetrahydroxy-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-6-one | ChEBI |
| Lycoricidin-A | ChEBI |
| Lycoricidinol | ChEBI |
| Narciclasine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:29477-83-6 | KEGG COMPOUND |
| CAS:29477-83-6 | ChemIDplus |
| Citations |
|---|