EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N4O2 |
| Net Charge | 0 |
| Average Mass | 372.428 |
| Monoisotopic Mass | 372.15863 |
| SMILES | O=C1N[C@H](Cc2cnc3ccccc23)C(=O)N[C@H]1Cc1cnc2ccccc12 |
| InChI | InChI=1S/C22H20N4O2/c27-21-19(9-13-11-23-17-7-3-1-5-15(13)17)25-22(28)20(26-21)10-14-12-24-18-8-4-2-6-16(14)18/h1-8,11-12,19-20,23-24H,9-10H2,(H,25,28)(H,26,27)/t19-,20+ |
| InChIKey | DNHODRZUCGXYKU-BGYRXZFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (21126094) | Ethyl acetate extract of culture filtrate Strain: KF620 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fellutanine (CHEBI:70168) has role Penicillium metabolite (CHEBI:76964) |
| fellutanine (CHEBI:70168) has role antibacterial agent (CHEBI:33282) |
| fellutanine (CHEBI:70168) is a 2,5-diketopiperazines (CHEBI:65061) |
| fellutanine (CHEBI:70168) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| (3R,6S)-3,6-bis(1H-indol-3-ylmethyl)piperazine-2,5-dione |
| Synonyms | Source |
|---|---|
| cyclo-(L-Trp-D-Trp) | ChEBI |
| cyclo(Trp-Trp) | ChEBI |
| fellutanine A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8651145 | Reaxys |
| Citations |
|---|