EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N4O2 |
| Net Charge | 0 |
| Average Mass | 372.428 |
| Monoisotopic Mass | 372.15863 |
| SMILES | O=C1N[C@H](Cc2cnc3ccccc23)C(=O)N[C@H]1Cc1cnc2ccccc12 |
| InChI | InChI=1S/C22H20N4O2/c27-21-19(9-13-11-23-17-7-3-1-5-15(13)17)25-22(28)20(26-21)10-14-12-24-18-8-4-2-6-16(14)18/h1-8,11-12,19-20,23-24H,9-10H2,(H,25,28)(H,26,27)/t19-,20+ |
| InChIKey | DNHODRZUCGXYKU-BGYRXZFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (21126094) | Ethyl acetate extract of culture filtrate Strain: KF620 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fellutanine (CHEBI:70168) has role Penicillium metabolite (CHEBI:76964) |
| fellutanine (CHEBI:70168) has role antibacterial agent (CHEBI:33282) |
| fellutanine (CHEBI:70168) is a 2,5-diketopiperazines (CHEBI:65061) |
| fellutanine (CHEBI:70168) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| (3R,6S)-3,6-bis(1H-indol-3-ylmethyl)piperazine-2,5-dione |
| Synonyms | Source |
|---|---|
| fellutanine A | ChEBI |
| cyclo(Trp-Trp) | ChEBI |
| cyclo-(L-Trp-D-Trp) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8651145 | Reaxys |
| Citations |
|---|