EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O5 |
| Net Charge | 0 |
| Average Mass | 298.294 |
| Monoisotopic Mass | 298.08412 |
| SMILES | O=C1OCC(Cc2ccc(O)cc2)=C1c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H14O5/c18-13-3-1-10(2-4-13)5-12-9-22-17(21)16(12)11-6-14(19)8-15(20)7-11/h1-4,6-8,18-20H,5,9H2 |
| InChIKey | QHJKSEDOBYAWIB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (21126094) | Ethyl acetate extract of culture filtrate Strain: KF620 |
| Roles Classification |
|---|
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eutypoid D (CHEBI:70166) has role Penicillium metabolite (CHEBI:76964) |
| eutypoid D (CHEBI:70166) is a butenolide (CHEBI:50523) |
| eutypoid D (CHEBI:70166) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3-(3,5-dihydroxyphenyl)-4-(4-hydroxybenzyl)furan-2(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21218500 | Reaxys |
| Citations |
|---|