EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42ClNO6 |
| Net Charge | 0 |
| Average Mass | 488.065 |
| Monoisotopic Mass | 487.27007 |
| SMILES | CCCCCCC[C@@H](C/C=C/CCC(=O)NC/C(=C/Cl)[C@@H]1C(=O)[C@H](O)C[C@@H](O)[C@]1(C)O)OC |
| InChI | InChI=1S/C25H42ClNO6/c1-4-5-6-7-9-12-19(33-3)13-10-8-11-14-22(30)27-17-18(16-26)23-24(31)20(28)15-21(29)25(23,2)32/h8,10,16,19-21,23,28-29,32H,4-7,9,11-15,17H2,1-3H3,(H,27,30)/b10-8+,18-16-/t19-,20+,21+,23+,25-/m0/s1 |
| InChIKey | OEGLIHPBLJQCGW-DRBFKITJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya (ncbitaxon:28073) | - | PubMed (21155594) | Dichloromethane/Methanol (2:1) extract |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malyngamide 2 (CHEBI:70161) has role metabolite (CHEBI:25212) |
| Malyngamide 2 (CHEBI:70161) is a monoterpenoid (CHEBI:25409) |
| Synonym | Source |
|---|---|
| (E,7S)-N-[(E)-3-chloro-2-[(1S,2R,3R,5R)-2,3,5-trihydroxy-2-methyl-6-oxocyclohexyl]prop-2-enyl]-7-methoxytetradec-4-enamide | ChEBI |
| Citations |
|---|