EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O |
| Net Charge | 0 |
| Average Mass | 216.324 |
| Monoisotopic Mass | 216.15142 |
| SMILES | CC(C)=CC(=O)C[C@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20O/c1-11(2)9-15(16)10-13(4)14-7-5-12(3)6-8-14/h5-9,13H,10H2,1-4H3/t13-/m0/s1 |
| InChIKey | NAAJVHHFAXWBOK-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peltophorum dasyrachis (IPNI:513013-1) | - | PubMed (21189039) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(S)-ar-turmerone (CHEBI:70159) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| (+)-(S)-ar-turmerone (CHEBI:70159) has role plant metabolite (CHEBI:76924) |
| (+)-(S)-ar-turmerone (CHEBI:70159) is a enone (CHEBI:51689) |
| (+)-(S)-ar-turmerone (CHEBI:70159) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (6S)-2-methyl-6-(4-methylphenyl)hept-2-en-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3606512 | Reaxys |
| CAS:532-65-0 | ChemIDplus |
| Citations |
|---|