EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O3 |
| Net Charge | 0 |
| Average Mass | 242.274 |
| Monoisotopic Mass | 242.09429 |
| SMILES | C[C@H]1OC2=C(C(=O)C(=O)c3ccccc32)C1(C)C |
| InChI | InChI=1S/C15H14O3/c1-8-15(2,3)11-13(17)12(16)9-6-4-5-7-10(9)14(11)18-8/h4-8H,1-3H3/t8-/m1/s1 |
| InChIKey | WGENOABUKBFVAA-MRVPVSSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptocarpus dunnii (ncbitaxon:121487) | - | PubMed (21174407) | Isolated from n-hexane extract of in vitro cultures of Streptocarpus dunnii |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-Dunnione, (rel)- (CHEBI:70154) has role metabolite (CHEBI:25212) |
| (3R)-Dunnione, (rel)- (CHEBI:70154) is a naphthofuran (CHEBI:39270) |
| Synonym | Source |
|---|---|
| rel-(2R)-2,3,3-trimethyl-2H-benzo[g][1]benzofuran-4,5-dione | ChEBI |
| Citations |
|---|