EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | CCCC(=O)CC[C@H]1OC(=O)c2c1cc(OC)c(OC)c2O |
| InChI | InChI=1S/C16H20O6/c1-4-5-9(17)6-7-11-10-8-12(20-2)15(21-3)14(18)13(10)16(19)22-11/h8,11,18H,4-7H2,1-3H3/t11-/m1/s1 |
| InChIKey | ZMZJTAURJHTVMU-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum (ncbitaxon:34409) | - | PubMed (21174408) | Crude ethylacetate extract of culture broth of endophytic fungus isolated from Piper ornatum Strain: CRI535 02 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colletotrialide, (+)- (CHEBI:70153) has role metabolite (CHEBI:25212) |
| Colletotrialide, (+)- (CHEBI:70153) is a 2-benzofurans (CHEBI:38831) |
| Synonym | Source |
|---|---|
| (+)-(3R)-7-hydroxy-5,6-dimethoxy-3-(3-oxohexyl)-3H-2-benzofuran-1-one | ChEBI |
| Citations |
|---|